5-Hydroxymethyl-2'-deoxyuridine 5'-monophosphate Sodium
5-Hydroxymethyl-2'-deoxyuridine 5'-monophosphate Sodium is a nucleotide that can be used in DNA bioresearch and repair, as well as cancer treatment. It inhibits the synthesis of DNA by binding to the enzyme DNMT1 and causing it to lose its ability to produce DNA. It also suppresses RNA synthesis to induce cell death.
Supplier | BOC Sciences |
---|---|
Product # | B2693-076438 |
Pricing | Inquire |
Cas | 160509-68-2 |
Molecular Weight | 360.19 |
Molecular Formula | C10H14N2NaO9P |
Canonical SMILES | [Na].O=C1NC(=O)N(C=C1CO)C2OC(COP(=O)(O)O)C(O)C2 |