N-Acetyl-β-neuraminic acid methyl ester
N-Acetyl-β-neuraminic acid methyl ester is an indispensable compound widely renowned for its capability to imitate sialic acid. This methyl ester derivative showcases an extensive array of applications in the research of diverse ailments such as cancer, neurodegenerative disorders and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2705-149794 |
| Pricing | Inquire |
| Cas | 22900-11-4 |
| Molecular Weight | 323.30 |
| Molecular Formula | C12H21NO9 |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)OC)O)O |