N-Acetyl-β-Asp-Glu
N-Acetyl-β-Asp-Glu, the third-most-prevalent peptide neurotransmitter in the mammalian nervous system, is a non-hydrolyzable NAAG isomer that is a selective metabotropic glutamate receptor-3 (mGluR3) antagonist and NAAG peptidase inhibitor. It is a mast cell stabilizer and can be used for allergic conjunctivitis and other allergic diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015077 |
| Pricing | Inquire |
| Cas | 4910-46-7 |
| Molecular Weight | 304.25 |
| Molecular Formula | C11H16N2O8 |
| Canonical SMILES | CC(=O)NC(CC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |