2'-Deoxy-2'-fluoroarabinoinosine
2'-Deoxy-2'-fluoroarabinoinosine is a nucleoside analog used in the treatment of viral infections such as hepatitis C and B. It exhibits potent antiviral activity by inhibiting viral RNA synthesis and acting as a chain terminator during viral genome replication. It has also been studied for its potential use in cancer treatment due to its ability to interfere with DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 98983-40-5 |
| Pricing | Inquire |
| Cas | 98983-40-5 |
| Molecular Weight | 270.22 |
| Molecular Formula | C10H11FN4O4 |
| Canonical SMILES | C1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)CO)O)F |