N-Acetyl-2,3-dehydro-2-deoxyneuraminic acid
N-acetyl-2,3-dehydro-2-Deoxyneuraminic Acid is a potent neuraminidase (sialidase) inhibitor. It shows inhibitory activities against human neuraminidase enzymes with IC50s of 143, 43, 61, and 74 μM for NEU1, NEU2, NEU3, and NEU4, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24967-27-9 |
| Pricing | Inquire |
| Cas | 24967-27-9 |
| Molecular Weight | 291.25 |
| Molecular Formula | C11H17NO8 |
| Canonical SMILES | CC(=O)NC1C(C=C(OC1C(C(CO)O)O)C(=O)O)O |