Amidepsine C
It is produced by the strain of Humicola sp. FO-2942. It inhibits DGAT activity, and the IC50 of rat liver microsomes DGAT is 51.6 X 10-6mol/L. It also inhibits triacylglycerol formation in intact Raji cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00440 |
| Pricing | Inquire |
| Cas | 169181-30-0 |
| Molecular Weight | 581.57 |
| Molecular Formula | C30H31NO11 |
| Canonical SMILES | CC1=CC(=CC(=C1C(=O)OC2=CC(=C(C(=C2)C)C(=O)OC3=CC(=C(C(=C3)C)C(=O)NC(C(C)C)C(=O)O)O)O)O)OC |