Panaxcerol C
Monogalactosyldiacylglycerol (MGDG) and digalactosyldiacylglycerol (DGDG) are the two nonionic lipid constituents of the thylakoid membrane of higher plant chloroplasts. MGDG and DGDG are present in the membrane at 56% and 29%, respectively, of the total lipid content. DGDG is a bilayer-forming lipid, while MGDG alone will only form hexagonal-II structures.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-031639 |
| Pricing | Inquire |
| Cas | 63180-02-9 |
| Molecular Weight | 775.06 |
| Molecular Formula | C45H74O10 |
| Canonical SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)CO)O)O)O)OC(=O)CCCCCCCC=CCC=CCC=CCC |