1-Azetidinecarboxamide, 3-(1-methylethoxy)-N-[[2-methyl-4-[2-[(1-methyl-1H-pyrazol-4-yl)amino]-4-pyrimidinyl]phenyl]methyl]-
BIIB068 is a potent, selective, reversible and orally active BTK inhibitor with an IC50 of 1 nM and Kd of 0.3 nM. BIIB068 shows more >400-fold selectivity for BTK than other kinases, and has the potential for autoimmune diseases research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1798787-27-5 |
| Pricing | Inquire |
| Cas | 1798787-27-5 |
| Molecular Weight | 435.52 |
| Molecular Formula | C23H29N7O2 |
| Canonical SMILES | CC1=C(C=CC(=C1)C2=NC(=NC=C2)NC3=CN(N=C3)C)CNC(=O)N4CC(C4)OC(C)C |