2'-O-tert-Butyldimethylsilyl-5'-O-DMT-C2-methyladenosine 3'-CE phosphoramidite
2'-O-tert-Butyldimethylsilyl-5'-O-DMT-C2-methyladenosine 3'-CE phosphoramidite: This phosphoramidite derivative is essential in the biomedical industry for synthesizing modified RNA molecules. It acts as a building block during solid-phase RNA synthesis, enabling the introduction of 2'-O-tert-butyldimethylsilyl, 5'-O-DMT, and C2-methyladenosine modifications. This phosphoramidite facilitates research on RNA structure-function relationships, post-transcriptional modifications, and drug discovery targeting diseases like cancer and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1028723-99-0 |
| Pricing | Inquire |
| Cas | 1028723-99-0 |
| Molecular Weight | 867.14 |
| Molecular Formula | C47H64N7O7Si |
| Canonical SMILES | CC1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N)O[Si](C)(C)C(C)(C)C)N |