Hybridaphniphylline B
Hybridaphniphylline B, a naturally occurring product, has shown considerable potential as an immunomodulatory agent. It has been extensively studied for its anti-inflammatory and analgesic properties, with growing interest in its potential efficacy in treating various inflammatory and chronic pain conditions. Despite its proven therapeutic potential, the precise mechanism of action of Hybridaphniphylline B is still under investigation, and further research is necessary to fully understand its pharmacological properties. This remarkable natural product holds great promise for the development of novel therapeutic interventions that can improve the lives of people suffering from chronic inflammatory disorders.
Supplier | BOC Sciences |
---|---|
Product # | NP0150 |
Pricing | Inquire |
Cas | 1467083-09-5 |
Molecular Weight | 681.78 |
Molecular Formula | C37H47NO11 |
Canonical SMILES | CC1CN2CC3CCC4=C5C6(CCC57C3(C2CC1C7=O)C)CC4C8C69C1C(C=C(C1C(O8)OC1C(C(C(C(O1)CO)O)O)O)CO)OC9=O |