3,5-O-Isopropylidene-D-lyxono-1,4-lactone
3,5-O-Isopropylidene-D-lyxono-1,4-lactone, a widely-employed chemical compound in biomedicine, serves as a fundamental precursor for the synthesis of various pharmaceuticals. Moreover, this versatile compound functions as a dynamic intermediate in the synthesis of synthetic compounds that exhibit interplay between antibacterial and anti-cancer properties. In addition, the application of this superlative compound to fabricate innovative biomaterials and drug delivery systems holds tremendous potential to revolutionize biomedical technologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 56543-11-4 |
| Pricing | Inquire |
| Cas | 56543-11-4 |
| Molecular Weight | 188.18 |
| Molecular Formula | C8H12O5 |
| Canonical SMILES | CC1(OCC2C(O1)C(C(=O)O2)O)C |