1,3,4,6-Tetra-O-acetyl-2-deoxy-2-N-phthalimido-a-D-glucopyranose
1,3,4,6-Tetra-O-acetyl-2-deoxy-2-N-phthalimido-a-D-glucopyranose, a chemical compound utilized in the production of glycopeptide antibiotics, demonstrates its functional potential as an acyl donor in the course of synthesizing vancomycin derivatives. Resistant against MRSA and other drug-resistance bacteria, these derivatives showcase their potential to alleviate the issues precipitated by such pathogens.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31505-44-9 |
| Pricing | Inquire |
| Cas | 31505-44-9 |
| Molecular Weight | 477.42 |
| Molecular Formula | C22H23NO11 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)N2C(=O)C3=CC=CC=C3C2=O)OC(=O)C)OC(=O)C |