Sennoside C
Aloe-emodin anthrone and rhein anthrone, formed mainly by intraluminal bacterial action, are the true active metabolites of Sennoside C in mice and that both anthrones synergistically exert their purgative effects on mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37271-16-2 |
| Pricing | Inquire |
| Cas | 37271-16-2 |
| Molecular Weight | 848.76 |
| Molecular Formula | C42H40O19 |
| Canonical SMILES | C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2C5C6=C(C(=CC=C6)OC7C(C(C(C(O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)CO |