Paldimycin A
It is produced by the strain of Str. paulus 273. It has anti-gram-positive bacterial effect, but also has weak anti-gram-negative bacterial effect. Paldimycin A has stronger antibacterial activity than Paldimycin B.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02347 |
| Pricing | Inquire |
| Cas | 101411-70-5 |
| Molecular Weight | 1113.18 |
| Molecular Formula | C44H64N4O23S3 |
| Canonical SMILES | CCC(C)C(=O)OC(C)C1(C(OC(CC1OC)OC2C(C(OC(C2OC(=O)C(C(C)SCC(C(=O)O)NC(=O)C)NC(=S)SCC(C(=O)O)NC(=O)C)COC(=O)C)C3(CC(=O)C(=N)C(=C3O)C(=O)O)O)O)C)O |