N-Acetyl Adamantamine-[d3]
N-Acetyl Adamantamine-[d3] is the labelled analogue of N-Acetyl Adamantamine, which is a metabolite of Adamantamine. Amantadine can be used as an antiviral and an anti-Parkinson drug. It is an NMDA receptor antagonist.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004885 |
| Pricing | Inquire |
| Cas | 1217704-63-6 |
| Molecular Weight | 196.30 |
| Molecular Formula | C12H16D3NO |
| Canonical SMILES | CC(=O)NC12CC3CC(C1)CC(C3)C2 |