N-Acetyl-2'-deoxy-2',2'-difluorocytidine
N-Acetyl-2'-deoxy-2',2'-difluorocytidine is an astounding compound with efficacious potential, considered a formidable tool for its remarkable antiviral attributes. It vehemently studys an extensive array of viral afflictions encompassing respiratory syncytial virus (RSV), influenza and hepatitis C virus (HCV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1026184-06-4 |
| Pricing | Inquire |
| Cas | 1026184-06-4 |
| Molecular Weight | 305.23 |
| Molecular Formula | C11H13F2N3O5 |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2C(C(C(O2)CO)O)(F)F |