2'-Deoxycytidine-3'-monophosphate disodium salt
2'-Deoxycytidine-3'-monophosphate disodium salt, a nucleotide analog frequently applied in anticancer treatment, has exhibited high effectiveness due to its exceptional ability to impede DNA synthesis, either used alone or combined with other chemotherapeutic agents. Additionally, this product has found popular use in DNA sequencing and PCR amplification, attesting to its versatility and promise in the field of science and medicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 102814-05-1 |
| Pricing | Inquire |
| Cas | 102814-05-1 |
| Molecular Weight | 351.16 |
| Molecular Formula | C9H12N3Na2O7P |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)CO)OP(=O)([O-])[O-].[Na+].[Na+] |