N-Acetyl-D-lactosamine
N-Acetyl-D-lactosamine, a paramount constituent within the biomedical realm, has showcased its indispensability in the creation of pharmaceuticals that specifically target distinct ailments. Remarkably, it assumes a pivotal function in the formulation of therapeutic remedies intended for maladies such as cystic fibrosis and various respiratory tract infections. Furthermore, this compound exhibits immense potential for synthesizing glycoproteins and glycolipids, thereby fueling progressive strides in the frontier of drug exploration and advancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 32181-59-2 |
| Pricing | Inquire |
| Cas | 32181-59-2 |
| Molecular Weight | 383.35 |
| Molecular Formula | C14H25NO11 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1O)CO)OC2C(C(C(C(O2)CO)O)O)O)O |