Kistamicin B
Kistamicin B is produced by the strain of Microtetraspora parvasata subsp. kistna. It has antiviral effect, and its ID50 (μg/mL) against influenza virus MDCK cells and herpes simplex virus are respectively 1.8 and 30.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01549 |
| Pricing | Inquire |
| Cas | 155683-51-5 |
| Molecular Weight | 1318.73 |
| Molecular Formula | C70H60ClN9O16 |
| Canonical SMILES | C1C2C(=O)NC(C3=CC(=C(C=C3)O)OC4=C(C=C(C=C4)C(C(=O)N2)NC(=O)C5C6=CC(=C(C(=C6)OC7=CC=C1C=C7)O)C8=CC9=C(C=C8)C(=CN9)CC(C(=O)NC(C(=O)N5)C1=CC(=CC(=C1)O)O)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)NCCC1=CC=CC=C1)Cl)C(=O)O |