Guanosine-2'(3')-monophosphate disodium salt
Guanosine-2'(3')-monophosphate disodium salt, a remarkable biomedicine product, emerges as a potent weapon in combating a myriad of multifarious diseases. Its unrivaled prowess as a precursor to cyclic guanosine monophosphate, an integral second messenger orchestrating intricate cellular signaling pathways, renders it indispensable.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70347-42-1 |
| Pricing | Inquire |
| Cas | 70347-42-1 |
| Molecular Weight | 407.18 |
| Molecular Formula | C10H12N5O8PNa2 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)OP(=O)([O-])[O-])N=C(NC2=O)N.[Na+].[Na+] |