N-Acetyl-2-O-methyl-a-neuraminic acid methyl ester 4,7,8,9-tetraacetate
N-Acetyl-2-O-methyl-a-neuraminic acid methyl ester 4,7,8,9-tetraacetate, a remarkable biomedical compound, is extensively employed for the treatment of targeted viral infections. By impeding the replication of specific viral strains, it exerts potent antiviral effects, resulting in a substantial decrease in viral load.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73208-80-7 |
| Pricing | Inquire |
| Cas | 73208-80-7 |
| Molecular Weight | 505.47 |
| Molecular Formula | C21H31NO13 |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(COC(=O)C)OC(=O)C)OC(=O)C)(C(=O)OC)OC)OC(=O)C |