Thymidine 5'-monophosphate p-nitrophenyl ester sodium salt
Thymidine 5'-monophosphate p-nitrophenyl ester sodium salt is a vital compound, finding itself extensively utilized for diverse applications. Functioning as a precursor during the synthesis of antiviral and antitumor compounds, it contributes significantly to the research of viral infections and select malignancies. Its distinctive sodium salt configuration furthers the compound's stability and solubility, rendering it exceptionally suitable for employment in pharmaceutical research and development endeavors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 98179-10-3 |
| Pricing | Inquire |
| Cas | 98179-10-3 |
| Molecular Weight | 465.28 |
| Molecular Formula | C16H17N3NaO10P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OC3=CC=C(C=C3)[N+](=O)[O-])O.[Na] |