2'-Deoxy-2'-methylcytidine
2'-Deoxy-2'-methylcytidine, a remarkable compound employed within the biomedical sector, boasts remarkable potency as an antiviral agent. Its efficacy extends to combating a multitude of RNA viruses, encompassing both flaviviruses and coronaviruses, rendering it indispensable in the creation of therapeutic antiviral medications to tackle afflictions like hepatitis C, Zika virus infection, and COVID-19.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115494-53-6 |
| Pricing | Inquire |
| Cas | 115494-53-6 |
| Molecular Weight | 241.24 |
| Molecular Formula | C10H15N3O4 |
| Canonical SMILES | CC1C(C(OC1N2C=CC(=NC2=O)N)CO)O |