Gemcitabine Triphosphate
Gemcitabine Triphosphate is a compelling antineoplastic compound, holding immense potential in studying a multitude of cancers such as non-small cell lung cancer, pancreatic cancer and ovarian cancer. Its innovative mechanism inhibits DNA synthesand repair, thus effectively hindering the growth and propagation of malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 110988-86-8 |
| Pricing | Inquire |
| Cas | 110988-86-8 |
| Molecular Weight | 503.14 |
| Molecular Formula | C9H14F2N3O13P3 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)(F)F |