5'-O-(Dimethoxytrityl)-5-methyl-3'-deoxyuridine
5'-O-(Dimethoxytrityl)-5-methyl-3'-deoxyuridine, commonly known as DMDU, stands as a paramount compound within the biomedicine realm. Its application in the synthesis of nucleoside analogs holds immense significance, fostering the advancement of antiviral and anticancer drugs. Through the inhibition of DNA replication, DMDU assists in grappling with viral infections such as HIV and diverse malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114551-15-4 |
| Pricing | Inquire |
| Cas | 114551-15-4 |
| Molecular Weight | 544.49 |
| Molecular Formula | C31H32N2O7 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(CC(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |