N-Acetyl-glucosaminyl thiazoline
N-Acetyl-glucosaminyl thiazoline is an O-GlcNAcase inhibitor (Ki = 180 nM) and is active against Vibrio campbellii with MIC of 0.5 μM. N-Acetyl-glucosaminyl thiazoline, a biomedical research element, has exceptional potential in fighting diseases and ailments. Linked to inhibiting the activities of glycosyltransferases, critical enzymes proliferating cancer, it proves a compelling solution for cancer therapy. Moreover, it has exhibited substantial efficacy against inflammatory diseases such as rheumatoid arthritis, mainly from its ability to activate immune cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 179030-22-9 |
| Pricing | Inquire |
| Cas | 179030-22-9 |
| Molecular Weight | 219.26 |
| Molecular Formula | C8H13NO4S |
| Canonical SMILES | CC1=NC2C(C(C(OC2S1)CO)O)O |