Cytidine 5'-triphosphate, sodium salt hydrate
Cytidine 5'-triphosphate, sodium salt hydrate is a nucleotide derivative containing cytidine. It consists of cytidine nucleoside linked to three phosphate groups at the 5' position. The sodium salt form enhances its solubility in aqueous solutions. This compound serves as a building block in various enzymatic reactions involved in RNA synthesis and modification. It is utilized in molecular biology techniques like polymerase chain reaction (PCR), DNA sequencing, and RNA labeling.
| Supplier | BOC Sciences |
|---|---|
| Product # | 123334-07-6 |
| Pricing | Inquire |
| Cas | 123334-07-6 |
| Molecular Weight | 483.16 (anhydrous free acid) |
| Molecular Formula | C9H16N3O14P3.H2O.xNa |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |