N-Acetyl-D-mannosaminuronic acid
N-Acetyl-D-mannosaminuronic acid is a vital compound extensively utilized within the biomedicine realm for its remarkable capacity to combat bacterial infections. By disrupting cell wall synthesis, it effectively impedes the proliferation of bacteria. Furthermore, ongoing scientific explorations are investigating its intriguing potential in the realms of cancer and autoimmune disease treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 57496-35-2 |
| Pricing | Inquire |
| Cas | 57496-35-2 |
| Molecular Weight | 235.19 |
| Molecular Formula | C8H13NO7 |
| Canonical SMILES | CC(=O)NC(C=O)C(C(C(C(=O)O)O)O)O |