Lavendustin C
Lavendustin C, also known as HDBA and NSC 666251, inhibits Ca2+/CaMKII (calmodulin kinase II) (IC50=0.2 μM), EGFR tyrosine kinase (IC50=44 nM) and SRC (IC50=0.5 μM). At a concentration of 10-150 µM, Lavendustin C inhibits tyrosine kinase-associated neutrophil degranulation and superoxide generation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125697-93-0 |
| Pricing | Inquire |
| Cas | 125697-93-0 |
| Molecular Weight | 275.26 |
| Molecular Formula | C14H13NO5 |
| Canonical SMILES | O=C(O)C1=CC(NCC2=CC(O)=CC=C2O)=CC=C1O |