3-Desaminosulfonyl 2-Aminosulfonyl N-Acetyl Dorzolamide
3-Desaminosulfonyl 2-Aminosulfonyl N-Acetyl Dorzolamide is an intermediate used in the synthesis of 2-Desaminosulfonyl 3-Aminosulfonyl Dorzolamide (D288235), which is a useful synthetic compound. Also, it is derived from (4R,6S)-5,6-Dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol 7,7-Dioxide (T344510), which is an analog of topically-active carbonic anhydrase inhibitor MK-507, commonly known Dorzolamide (D535100).
Supplier | BOC Sciences |
---|---|
Product # | BB068461 |
Pricing | Inquire |
Cas | 403848-30-6 |
Molecular Weight | 385.91 |
Molecular Formula | C12H16ClNO5S3 |
Canonical SMILES | CCN(C1CC(S(=O)(=O)C2=C1C=C(S2)S(=O)(=O)Cl)C)C(=O)C |