Zygosporin E
Zygosporin E is produced by the strain of Zygosporium masonii MFC-612 and Zygosporium mycophylum MFC-702. It is cytotoxic to HeLa cells with ED50 of 0.4 μg/mL. It has anti-tumor and anti-inflammatory properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02983 |
| Pricing | Inquire |
| Cas | 26399-27-9 |
| Molecular Weight | 491.62 |
| Molecular Formula | C30H37NO5 |
| Canonical SMILES | CC1CC=CC2C(C(=C)C(C3C2(C(C=CC(C1=O)C)OC(=O)C)C(=O)NC3CC4=CC=CC=C4)C)O |