Anthraquinone-2,3-dicarboxylic Acid
Anthraquinone-2,3-dicarboxylic Acid is an imperative compound in the field of biomedicine and manifests remarkable anticancer attributes, endowing it with invaluable utility in the efficacious management of diverse cancer types such as breast, lung, and colon cancers. Its profound capability to impede the proliferation of malignant cells and evoke programmed cell death, known as apoptosis, harbors immense promise for the advancement of specifically tailored therapeutic interventions targeting these debilitating ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27485-15-0 |
| Pricing | Inquire |
| Cas | 27485-15-0 |
| Molecular Weight | 296.23 |
| Molecular Formula | C16H8O6 |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C=C3C2=O)C(=O)O)C(=O)O |