Irinotecan EP Impurity E (SN-38)
An impurity of Irinotecan, a Topoisomerase I inhibitor used for the treatment of colon cancer and small cell lung cancer. It inhibits DNA and RNA synthesis with IC50s of 0.077 and 1.3 μM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01393 |
| Pricing | Inquire |
| Cas | 86639-52-3 |
| Molecular Weight | 392.40 |
| Molecular Formula | C22H20N2O5 |
| Canonical SMILES | CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)C4(CC)O)C2=NC5=C1C=C(C=C5)O |