N-Acetyl-2,7-anhydro-a-neuraminic acid
N-Acetyl-2,7-anhydro-α-neuraminic acid, a pivotal compound in the realm of biomedicine, showcases its indispensability. Researchers extensively exploit this compound to elucidate and combat a myriad of glycosylation-linked ailments. It serves as an invaluable asset in fabricating drugs aimed at regulating sialic acid-mediated physiological mechanisms, encompassing virulent contagions and malignant metastasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 95574-95-1 |
| Pricing | Inquire |
| Cas | 95574-95-1 |
| Molecular Weight | 291.25 |
| Molecular Formula | C11H17NO8 |
| Canonical SMILES | CC(=O)NC1C(CC2(OC1C(O2)C(CO)O)C(=O)O)O |