2-Chloro-5-nitrobenzoic acid
2-Chloro-5-nitrobenzoic Acid is used in the synthesis of sesquiterpenoids as potential antibacterial compounds. It is also used in the synthesis of substituted phenyl oxazoles as novel LSD1 inhibitors with antiproliferative activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2516-96-3 |
| Pricing | Inquire |
| Cas | 2516-96-3 |
| Molecular Weight | 201.56 |
| Molecular Formula | C7H4ClNO4 |
| Canonical SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl |