Manzamine A
Manzamine A is an alkaloid in the class of β-carboline isolated from the marine sponges. It acts as an inhibitor of glycogen synthase kinase 3β (GSK3β). It exhibits inhibitory effects against growth of the rodent malaria parasite Plasmodium berghei in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-196790 |
| Pricing | Inquire |
| Cas | 104196-68-1 |
| Molecular Weight | 548.8 |
| Molecular Formula | C36H44N4O |
| Canonical SMILES | C1CCN2CCC3C(=CC(CCC=CC1)(C4C3(C2)CC5N4CCCCC=C5)O)C6=NC=CC7=C6NC8=CC=CC=C78 |