Cinerubin A
It is produced by the strain of Streptomyces cinereoruber var. fructo fermentans. Cinerubin A has anti-gram-positive bacteria, mycobacterium, fungis and amoeba activity, and has strong effect on mouse adenocarcinoma E0771.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00341 |
| Pricing | Inquire |
| Cas | 34044-10-5 |
| Molecular Weight | 827.87 |
| Molecular Formula | C42H53NO16 |
| Canonical SMILES | CCC1(CC(C2=C(C3=C(C=C2C1C(=O)OC)C(=O)C4=C(C=CC(=C4C3=O)O)O)O)OC5CC(C(C(O5)C)OC6CC(C(C(O6)C)OC7CCC(=O)C(O7)C)O)N(C)C)O |