1,3,4,6-Tetra-O-acetyl-2-[(2-aminoacetyl)amino]-2-deoxy-a-D-glucopyranose
1,3,4,6-Tetra-O-acetyl-2-[(2-aminoacetyl)amino]-2-deoxy-a-D-glucopyranose, commonly referred to as TAAAG, serves as a vital chemical compound in the biomedical industry. Its application as a precursor to chitin synthesis inhibitors makes it an integral aspect of fungal infection and pest control treatment. The complex molecular structure of TAAAG has shown to impede chitin formation and thus, hinder fungal growth and pest development. Advanced research utilizing TAAAG has shown to provide exceptional results, making it an essential component for a myriad of biomedical applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 47577-85-5 |
| Pricing | Inquire |
| Cas | 47577-85-5 |
| Molecular Weight | 404.37 |
| Molecular Formula | C16H24N2O10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)CN)OC(=O)C)OC(=O)C |