2,4,7,8,9-Penta-O-acetyl N-acetylneuraminic acid
2,4,7,8,9-Penta-O-acetyl N-acetylneuraminic acid, also known as the vital compound in the biomedical sector, plays a pivotal role. This compound finds widespread application in crafting anti-influenza medications and therapeutically addressing specific illnesses. Its exceptional antiviral attributes make it a potent inhibitor of influenza virus replication within host cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4887-11-0 |
| Pricing | Inquire |
| Cas | 4887-11-0 |
| Molecular Weight | 519.45 |
| Molecular Formula | C21H29NO14 |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(COC(=O)C)OC(=O)C)OC(=O)C)(C(=O)O)OC(=O)C)OC(=O)C |