Atractyloside sodium salt
Atractyloside sodium salt is a valuable tool in compound used to study mitochondrial dysfunction and its role in diseases such as cancer, liver diseases and cardiovascular disorders. It is a potent inhibitor of mitochondrial adenine nucleotide translocase (ANT).
| Supplier | BOC Sciences |
|---|---|
| Product # | 100938-11-2 |
| Pricing | Inquire |
| Cas | 100938-11-2 |
| Molecular Weight | 770.77 |
| Molecular Formula | C30H44O16S2Na2 |
| Canonical SMILES | CC(C)CC(=O)OC1C(C(C(OC1OC2CC(C3CCC45CC(CCC4C3(C2)C)C(=C)C5O)C(=O)O)CO)OS(=O)(=O)[O-])OS(=O)(=O)[O-].[Na+].[Na+] |