L-R4W2
| Supplier | Creative Peptides |
|---|---|
| Product # | R0877 |
| CAS # | 206350-79-0 |
| Pricing | Inquire |
| LabelingTarget | Vanilloid TRPV1 (VR1) receptor |
| MolecularFormula | C46H71N21O6 |
| MolecularWeight | 1014.2 |
| Sequence | RRRRWW-NH2 |
| Storage | -20°C |
| Explanation | L-R4W2 is an antagonist of stereoselective vanilloid TRPV1 (VR1) receptor (IC50 ~ 0.1 µM), and blocks Ca2+ currents in dorsal root ganglion neurons. It is used as analgesic agent. |
| Activity | Antagonist |
| InChI | InChI=1S/C46H71N21O6/c47-29(11-5-17-57-43(49)50)38(69)63-32(14-6-18-58-44(51)52)39(70)64-33(15-7-19-59-45(53)54)40(71)65-34(16-8-20-60-46(55)56)41(72)67-36(22-26-24-62-31-13-4-2-10-28(26)31)42(73)66-35(37(48)68)21-25-23-61-30-12-3-1-9-27(25)30/h1-4,9-10,12-13,23-24,29,32-36,61-62H,5-8,11,14-22,47H2,(H2,48,68)(H,63,69)(H,64,70)(H,65,71)(H,66,73)(H,67,72)(H4,49,50,57)(H4,51,52,58)(H4,53,54,59)(H4,55,56,60)/t29-,32-,33-,34-,35-,36-/m0/s1 |
| InChIKey | MGQHBRDQUJRCLN-UJARKJSPSA-N |
| Solubility | Soluble in water |
| IsomericSMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)N)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCN=C(N)N)N |
| Appearance | White lyophilised solid |
| Purity | >98 % |
| LongTermStorageConditions | -20°C |