2-Ethoxy-5-methylphenylboronic acid
2-Ethoxy-5-methylphenylboronic Acid is a boronic acid derivative used as a key intermediate in the synthesis of certain biologically active compounds. It plays a significant role in the development and production of antiviral drugs and other pharmaceutical products targeting various diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 123291-97-4 |
| Pricing | Inquire |
| Cas | 123291-97-4 |
| Molecular Weight | 180.0087 |
| Molecular Formula | C9H13O3B |
| Canonical SMILES | B(C1=C(C=CC(=C1)C)OCC)(O)O |