Taurocholic Acid Sodium Salt Hydrate
Choleretic; Its sodium salt is a bile salt formed in the liver by conjugation of cholic acid with taurine that is involved in the emulsification of lipids used to solubilize lipids and membrane-bound proteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | 345909-26-4 |
| Pricing | Inquire |
| Cas | 345909-26-4 |
| Molecular Weight | 555.70 |
| Molecular Formula | C26H46NNaO8S |
| Canonical SMILES | CC(CCC(=O)NCCS(=O)(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.O.[Na+] |