2-Nitro-p-xylylene glycol
As an antibacterial agent, 2-Nitro-p-xylylene glycol can effectively inhibit the proliferation of harmful bacterial and fungal species, and can be used in the development of drugs to combat occult skin infections caused by bacteria or fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23222-97-1 |
| Pricing | Inquire |
| Cas | 23222-97-1 |
| Molecular Weight | 183.161 |
| Molecular Formula | C8H9NO4 |
| Canonical SMILES | C1=CC(=C(C=C1CO)[N+](=O)[O-])CO |