2-(Dicyclohexylphosphino)-2',4',6'-triisopropyl-3,6-dimethoxybiphenyl
Buchwald Phosphine Ligands for chemical Synthesis BrettPhos is a dialkylbiaryl phosphine ligand developed by the Buchwald group. It promotes cross-coupling reactions more efficiently and exhibits improved reactivity compared to other catalytic systems.It can be used in: palladium-catalyzed trifluoromethylation of aryl chlorides; Buchwald-Hartwig amination; synthesis of 4-aryl and alkyl substituted, N6-alkylated pyridazine-3,6-diamines via a Buchwald protocol.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB001964 |
| Pricing | Inquire |
| Cas | 1070663-78-3 |
| Molecular Weight | 536.77 |
| Molecular Formula | C35H53O2P |
| Canonical SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=C(C=CC(=C2P(C3CCCCC3)C4CCCCC4)OC)OC)C(C)C |