N-Formyl-1-amino-1-deoxy-D-glucitol
N-Formyl-1-amino-1-deoxy-D-glucitol, a compound exhibiting tremendous promise within the biomedical sector, engenders intrigue owing to its distinctive configuration. This extraordinary molecule portrays extraordinary potential in combating an array of ailments, inclusive of diabetes and cancer. Evidential research posits the capability of this compound to judiciously modulate glucose metabolism, facilitating increased insulin receptivity and diminished glycemic indices.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89182-60-5 |
| Pricing | Inquire |
| Cas | 89182-60-5 |
| Molecular Weight | 209.2 |
| Molecular Formula | C7H15NO6 |
| Canonical SMILES | C(C(C(C(C(CO)O)O)O)O)NC=O |