2-Acetamido-2-deoxy-3-O-(a-L-fucopyranosyl)-D-glucopyranose
2-Acetamido-2-deoxy-3-O-(α-L-fucopyranosyl)-D-glucopyranose is a highly significant compound within the biomedical sector, employed as a facilitator in the research and development of targeted drugs and therapeutic methodologies tailored to cellular receptors and signaling pathways .
| Supplier | BOC Sciences |
|---|---|
| Product # | 52630-68-9 |
| Pricing | Inquire |
| Cas | 52630-68-9 |
| Molecular Weight | 367.35 |
| Molecular Formula | C14H25NO10 |
| Canonical SMILES | CC1C(C(C(C(O1)OC(C(C=O)NC(=O)C)C(C(CO)O)O)O)O)O |