4-(1-Methylethyl)-N-[4-(1-methylethyl)phenyl]benzenamine
4-(1-Methylethyl)-N-[4-(1-methylethyl)phenyl]benzenamine is an intermediate in the synthesis of 2,7-Diisopropyl-9,9-dimethyl-9,10-dihydroacridine-d6 (D455762), which is a labeled analogue of 2,7-Diisopropyl-9,9-dimethyl-9,10-dihydroacridine (D455760), a useful chemical reagent. Also, it is derived from 9,9-Dimethyl-9,10-dihydroacridine (D474300), which are currently being used in the development of thermally activated delayed fluorescence (TADF) molecules which are being researched for their possible efficient deep- blue TADF emitting potential.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB076302 |
| Pricing | Inquire |
| Cas | 63451-41-2 |
| Molecular Weight | 253.38 |
| Molecular Formula | C18H23N |
| Canonical SMILES | CC(C)C1=CC=C(C=C1)NC2=CC=C(C=C2)C(C)C |