Explanation |
Cell permeable, potent and selective NADPH oxidase 1 (NOX1) inhibitor (IC50 = 20 nM), which exhibits selectivity for NOX1 over NOX2, NOX4, NOX5 and xanthine oxidase. It inhibits NOX1-derived O2- production in HT-29 human colon cancer cells, and attenuates VEGF-induced human pulmonary artery endothelial cell migration under hypoxic conditions in vitro.
|
InChI |
InChI=1S/C50H88N14O15/c1-25(2)22-33(44(73)55-24-36(65)58-31(14-9-11-19-51)45(74)56-28(7)42(71)59-32(15-10-12-20-52)46(75)62-39(26(3)4)41(54)70)60-43(72)29(8)57-47(76)34(23-38(68)69)61-49(78)40(27(5)6)63-48(77)35-16-13-21-64(35)50(79)30(53)17-18-37(66)67/h25-35,39-40H,9-24,51-53H2,1-8H3,(H2,54,70)(H,55,73)(H,56,74)(H,57,76)(H,58,65)(H,59,71)(H,60,72)(H,61,78)(H,62,75)(H,63,77)(H,66,67)(H,68,69)/t28-,29-,30-,31-,32-,33-,34-,35-,39-,40-/m0/s1
|