BIM 23056
| Supplier | Creative Peptides |
|---|---|
| Product # | R0827 |
| CAS # | 150155-61-6 |
| Pricing | Inquire |
| LabelingTarget | Somatostatin receptor 5 (sst5) |
| MolecularFormula | C71H81N11O9 |
| MolecularWeight | 1232.49 |
| Source | Synthetic |
| Sequence | FFYWKVFX (Modifications: Phe-1 = D-Phe, Trp-4 = D-Trp, X = D-Nal & C-terminal amide) |
| Storage | -20°C |
| Explanation | BIM 23056 behaves as a potent and selective antagonist of somatostatin receptor 5. |
| Activity | Antagonist |
| InChI | InChI=1S/C71H81N11O9/c1-44(2)63(71(91)81-61(39-47-22-10-5-11-23-47)67(87)77-58(64(74)84)41-49-29-32-50-24-12-13-25-51(50)36-49)82-66(86)57(28-16-17-35-72)76-70(90)62(42-52-43-75-56-27-15-14-26-54(52)56)80-69(89)60(40-48-30-33-53(83)34-31-48)79-68(88)59(38-46-20-8-4-9-21-46)78-65(85)55(73)37-45-18-6-3-7-19-45/h3-15,18-27,29-34,36,43-44,55,57-63,75,83H,16-17,28,35,37-42,72-73H2,1-2H3,(H2,74,84)(H,76,90)(H,77,87)(H,78,85)(H,79,88)(H,80,89)(H,81,91)(H,82,86)/t55-,57+,58-,59+,60+,61+,62-,63+/m1/s1 |
| InChIKey | VPTPBEUWKCLZGU-OOSWLFMASA-N |
| IsomericSMILES | CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@H](CC2=CC3=CC=CC=C3C=C2)C(=O)N)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC4=CNC5=CC=CC=C54)NC(=O)[C@H](CC6=CC=C(C=C6)O)NC(=O)[C@H](CC7=CC=CC=C7)NC(=O)[C@@H](CC8=CC=CC=C8)N |
| Appearance | White lyophilised solid |
| Purity | >98 % |
| LongTermStorageConditions | -20 °C |